Products 1416324-31-6
CAS 1416324-31-6 is the registry number for (S)-1-((1-Methyl-3-oxocyclohexyl)methyl)-1H-benzo[d]imidazole-6-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[[(1S)-1-methyl-3-oxocyclohexyl]methyl]benzimidazole-5-carbonitrile (CAS 1416324-31-6) is a chemical compound with the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. IUPAC name: 3-[[(1S)-1-methyl-3-oxocyclohexyl]methyl]benzimidazole-5-carbonitrile. InChIKey: RBRYPPQFTRUGFC-INIZCTEOSA-N.
| Molecular formula | C16H17N3O |
|---|---|
| Molecular weight | 267.33 g/mol |
| IUPAC name | 3-[[(1S)-1-methyl-3-oxocyclohexyl]methyl]benzimidazole-5-carbonitrile |
| InChIKey | RBRYPPQFTRUGFC-INIZCTEOSA-N |
| SMILES | C[C@@]1(CCCC(=O)C1)CN2C=NC3=C2C=C(C=C3)C#N |
Computed by PubChem (NCBI)