Products 1416338-09-4
CAS 1416338-09-4 appears in our catalog under these names: 7-Bromo-2-ethyl-1,2,3,4-tetrahydroisoquinoline, 97%, 7-Bromo-2-ethyl-1,2,3,4-tetrahydroisoquinoline, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
7-bromo-2-ethyl-3,4-dihydro-1H-isoquinoline (CAS 1416338-09-4) is a chemical compound with the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. IUPAC name: 7-bromo-2-ethyl-3,4-dihydro-1H-isoquinoline. InChIKey: NCOSMKSZJWWNEB-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN |
|---|---|
| Molecular weight | 240.14 g/mol |
| IUPAC name | 7-bromo-2-ethyl-3,4-dihydro-1H-isoquinoline |
| InChIKey | NCOSMKSZJWWNEB-UHFFFAOYSA-N |
| SMILES | CCN1CCC2=C(C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)