Products 1416345-12-4
CAS 1416345-12-4 is the registry number for 6-(4-Methoxy-phenyl)-6,7-dihydro-4h-[1,2,3]triazolo[5,1-c][1,4]oxazine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 5g.
6-(4-methoxyphenyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine-3-carboxylic acid (CAS 1416345-12-4) is a chemical compound with the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. IUPAC name: 6-(4-methoxyphenyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine-3-carboxylic acid. InChIKey: XPHIEVNGSMIXGB-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O4 |
|---|---|
| Molecular weight | 275.26 g/mol |
| IUPAC name | 6-(4-methoxyphenyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine-3-carboxylic acid |
| InChIKey | XPHIEVNGSMIXGB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2CN3C(=C(N=N3)C(=O)O)CO2 |
Computed by PubChem (NCBI)