CAS 400752-43-4 appears in our catalog under these names: 4-[(3,5-Dimethyl-4-nitro-1h-pyrazol-1-yl)methyl]benzoic acid, 95%, 4-((3,5-Dimethyl-4-nitro-1H-pyrazol-1-yl)methyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoic acid (CAS 400752-43-4) is a chemical compound with the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. IUPAC name: 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoic acid. InChIKey: YXAVYFPLSDBRDI-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O4 |
|---|---|
| Molecular weight | 275.26 g/mol |
| IUPAC name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoic acid |
| InChIKey | YXAVYFPLSDBRDI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=CC=C(C=C2)C(=O)O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)