CAS 2227990-64-7 appears in our catalog under these names: 4-(Cbz-amino)-1-methyl-1h-pyrazole-3-carboxylic acid, 95%, 4-(Cbz-amino)-1-methyl-1H-pyrazole-3-carboxylic Acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 5g, 1g.
1-methyl-4-(phenylmethoxycarbonylamino)pyrazole-3-carboxylic acid (CAS 2227990-64-7) is a chemical compound with the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. IUPAC name: 1-methyl-4-(phenylmethoxycarbonylamino)pyrazole-3-carboxylic acid. InChIKey: YHSJCPJYDLVWGX-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O4 |
|---|---|
| Molecular weight | 275.26 g/mol |
| IUPAC name | 1-methyl-4-(phenylmethoxycarbonylamino)pyrazole-3-carboxylic acid |
| InChIKey | YHSJCPJYDLVWGX-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)