CAS 1416351-80-8 appears in our catalog under these names: Sodium 2-(6-methylpyridin-2-yl)acetate, 95%, Sodium 2–(6–methylpyridin–2–yl)acetate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 10g, 100mg, 250mg, 5g.
Sodium 2-(6-methyl-2-pyridinyl)acetate (CAS 1416351-80-8) is a chemical compound with the molecular formula C8H8NNaO2 and a molecular weight of 173.14 g/mol. IUPAC name: sodium 2-(6-methyl-2-pyridinyl)acetate. InChIKey: ODMBIOQJFCXTLC-UHFFFAOYSA-M.
| Molecular formula | C8H8NNaO2 |
|---|---|
| Molecular weight | 173.14 g/mol |
| IUPAC name | sodium 2-(6-methyl-2-pyridinyl)acetate |
| InChIKey | ODMBIOQJFCXTLC-UHFFFAOYSA-M |
| SMILES | CC1=NC(=CC=C1)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)