CAS 64462-12-0 is the registry number for Diclofenac Impurity 35 Sodium Salt. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 2-(2-aminophenyl)acetate (CAS 64462-12-0) is a chemical compound with the molecular formula C8H8NNaO2 and a molecular weight of 173.14 g/mol. IUPAC name: sodium 2-(2-aminophenyl)acetate. InChIKey: HYMFGPNQDYYRRG-UHFFFAOYSA-M.
| Molecular formula | C8H8NNaO2 |
|---|---|
| Molecular weight | 173.14 g/mol |
| IUPAC name | sodium 2-(2-aminophenyl)acetate |
| InChIKey | HYMFGPNQDYYRRG-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)CC(=O)[O-])N.[Na+] |
Computed by PubChem (NCBI)