CAS 1909313-66-1 appears in our catalog under these names: Sodium 2-(pyridin-4-yl)propanoate, 95%, Sodium 2-(pyridin-4-yl)propanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Sodium 2-pyridin-4-ylpropanoate (CAS 1909313-66-1) is a chemical compound with the molecular formula C8H8NNaO2 and a molecular weight of 173.14 g/mol. IUPAC name: sodium 2-pyridin-4-ylpropanoate. InChIKey: CMFBHQLIELAZEO-UHFFFAOYSA-M.
| Molecular formula | C8H8NNaO2 |
|---|---|
| Molecular weight | 173.14 g/mol |
| IUPAC name | sodium 2-pyridin-4-ylpropanoate |
| InChIKey | CMFBHQLIELAZEO-UHFFFAOYSA-M |
| SMILES | CC(C1=CC=NC=C1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)