CAS 1416354-35-2 appears in our catalog under these names: 2-Aminoindan-2-phosphonic acid (hydrochloride), 98.42%, (2–Amino–2,3–dihydro–1H–inden–2–yl)phosphonic acid hydrochloride, (2-Amino-2,3-dihydro-1H-inden-2-yl)phosphonic acid hydrochloride, (2-Amino-2,3-dihydro-1H-inden-2-yl)phosphonic acid HCl 97%, (2-Amino-2,3-dihydro-1H-inden-2-yl)phosphonic acid hydrochloride, 97%. Offered by: MedChemExpress, GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 250 mg, 50 mg, 100 mg, 100mg, 250mg, 1g, 2g, 5g.
(2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride (CAS 1416354-35-2) is a chemical compound with the molecular formula C9H13ClNO3P and a molecular weight of 249.63 g/mol. IUPAC name: (2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride. InChIKey: VZZDWKUDNIOOBD-UHFFFAOYSA-N.
| Molecular formula | C9H13ClNO3P |
|---|---|
| Molecular weight | 249.63 g/mol |
| IUPAC name | (2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride |
| InChIKey | VZZDWKUDNIOOBD-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2CC1(N)P(=O)(O)O.Cl |
Computed by PubChem (NCBI)