CAS 2344679-93-0 is the registry number for 3-Amino-5-(dimethylphosphoryl)benzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-amino-5-dimethylphosphorylbenzoic acid;hydrochloride (CAS 2344679-93-0) is a chemical compound with the molecular formula C9H13ClNO3P and a molecular weight of 249.63 g/mol. IUPAC name: 3-amino-5-dimethylphosphorylbenzoic acid;hydrochloride. InChIKey: VOFRHXZURNGAGZ-UHFFFAOYSA-N.
| Molecular formula | C9H13ClNO3P |
|---|---|
| Molecular weight | 249.63 g/mol |
| IUPAC name | 3-amino-5-dimethylphosphorylbenzoic acid;hydrochloride |
| InChIKey | VOFRHXZURNGAGZ-UHFFFAOYSA-N |
| SMILES | CP(=O)(C)C1=CC(=CC(=C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)