Products 2344679-93-0

CAS 2344679-93-0 is the registry number for 3-Amino-5-(dimethylphosphoryl)benzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-amino-5-dimethylphosphorylbenzoic acid;hydrochloride (CAS 2344679-93-0) is a chemical compound with the molecular formula C9H13ClNO3P and a molecular weight of 249.63 g/mol. IUPAC name: 3-amino-5-dimethylphosphorylbenzoic acid;hydrochloride. InChIKey: VOFRHXZURNGAGZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13ClNO3P
Molecular weight249.63 g/mol
IUPAC name3-amino-5-dimethylphosphorylbenzoic acid;hydrochloride
InChIKeyVOFRHXZURNGAGZ-UHFFFAOYSA-N
SMILESCP(=O)(C)C1=CC(=CC(=C1)N)C(=O)O.Cl

Computed by PubChem (NCBI)