CAS 1416363-78-4 is the registry number for 6-Bromo-2,2-dimethylindolin-3-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2,2-dimethyl-1H-indol-3-one (CAS 1416363-78-4) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 6-bromo-2,2-dimethyl-1H-indol-3-one. InChIKey: ZDRXXZODMQCMEA-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 6-bromo-2,2-dimethyl-1H-indol-3-one |
| InChIKey | ZDRXXZODMQCMEA-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)C2=C(N1)C=C(C=C2)Br)C |
Computed by PubChem (NCBI)