Products 1416437-92-7

CAS 1416437-92-7 appears in our catalog under these names: Methyl 2,2-dimethylmorpholine-3-carboxylate hydrochloride, 97%, Methyl 2,2-dimethylmorpholine-3-carboxylate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2,2-dimethylmorpholine-3-carboxylate;hydrochloride (CAS 1416437-92-7) is a chemical compound with the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. IUPAC name: methyl 2,2-dimethylmorpholine-3-carboxylate;hydrochloride. InChIKey: TYAIRGQKBJVSNM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO3
Molecular weight209.67 g/mol
IUPAC namemethyl 2,2-dimethylmorpholine-3-carboxylate;hydrochloride
InChIKeyTYAIRGQKBJVSNM-UHFFFAOYSA-N
SMILESCC1(C(NCCO1)C(=O)OC)C.Cl

Computed by PubChem (NCBI)