CAS 1416445-03-8 is the registry number for (R)-Methyl 2,2-dimethylmorpholine-3-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl (3R)-2,2-dimethylmorpholine-3-carboxylate;hydrochloride (CAS 1416445-03-8) is a chemical compound with the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. IUPAC name: methyl (3R)-2,2-dimethylmorpholine-3-carboxylate;hydrochloride. InChIKey: TYAIRGQKBJVSNM-RGMNGODLSA-N.
| Molecular formula | C8H16ClNO3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | methyl (3R)-2,2-dimethylmorpholine-3-carboxylate;hydrochloride |
| InChIKey | TYAIRGQKBJVSNM-RGMNGODLSA-N |
| SMILES | CC1([C@@H](NCCO1)C(=O)OC)C.Cl |
Computed by PubChem (NCBI)