Products 1416444-74-0
CAS 1416444-74-0 appears in our catalog under these names: (S)-Methyl 2,2-dimethylmorpholine-3-carboxylate hydrochloride, 97%, (S)-Methyl 2,2-dimethylmorpholine-3-carboxylate hydrochloride, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g.
Methyl (3S)-2,2-dimethylmorpholine-3-carboxylate;hydrochloride (CAS 1416444-74-0) is a chemical compound with the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. IUPAC name: methyl (3S)-2,2-dimethylmorpholine-3-carboxylate;hydrochloride. InChIKey: TYAIRGQKBJVSNM-FYZOBXCZSA-N.
| Molecular formula | C8H16ClNO3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | methyl (3S)-2,2-dimethylmorpholine-3-carboxylate;hydrochloride |
| InChIKey | TYAIRGQKBJVSNM-FYZOBXCZSA-N |
| SMILES | CC1([C@H](NCCO1)C(=O)OC)C.Cl |
Computed by PubChem (NCBI)