CAS 1416437-93-8 appears in our catalog under these names: 4-(tert-Butoxycarbonyl)-2,2-dimethylmorpholine-3-carboxylic acid, 97%, 4-((tert-Butoxy)carbonyl)-2,2-dimethylmorpholine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-3-carboxylic acid (CAS 1416437-93-8) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-3-carboxylic acid. InChIKey: GJZYDQLMLYHLAE-UHFFFAOYSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-3-carboxylic acid |
| InChIKey | GJZYDQLMLYHLAE-UHFFFAOYSA-N |
| SMILES | CC1(C(N(CCO1)C(=O)OC(C)(C)C)C(=O)O)C |
Computed by PubChem (NCBI)