CAS 1416438-39-5 appears in our catalog under these names: 2,4-Dichloro-6-cyclopropyl-5-fluoropyrimidine, 2,4-Dichloro-6-cyclopropyl-5-fluoropyrimidine, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 50mg, 0,5g, 250mg, 1g.
2,4-dichloro-6-cyclopropyl-5-fluoropyrimidine (CAS 1416438-39-5) is a chemical compound with the molecular formula C7H5Cl2FN2 and a molecular weight of 207.03 g/mol. IUPAC name: 2,4-dichloro-6-cyclopropyl-5-fluoropyrimidine. InChIKey: DCOTWAMPYCFXDA-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2FN2 |
|---|---|
| Molecular weight | 207.03 g/mol |
| IUPAC name | 2,4-dichloro-6-cyclopropyl-5-fluoropyrimidine |
| InChIKey | DCOTWAMPYCFXDA-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C(=NC(=N2)Cl)Cl)F |
Computed by PubChem (NCBI)