CAS 617716-22-0 is the registry number for 4,6-Dichloro-2-cyclopropyl-5-fluoropyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4,6-dichloro-2-cyclopropyl-5-fluoropyrimidine (CAS 617716-22-0) is a chemical compound with the molecular formula C7H5Cl2FN2 and a molecular weight of 207.03 g/mol. IUPAC name: 4,6-dichloro-2-cyclopropyl-5-fluoropyrimidine. InChIKey: IWEYDOPVUWBPGT-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2FN2 |
|---|---|
| Molecular weight | 207.03 g/mol |
| IUPAC name | 4,6-dichloro-2-cyclopropyl-5-fluoropyrimidine |
| InChIKey | IWEYDOPVUWBPGT-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC(=C(C(=N2)Cl)F)Cl |
Computed by PubChem (NCBI)