CAS 2172528-12-8 appears in our catalog under these names: 2-Chloro-6-fluoro-1h-1,3-benzodiazole hydrochloride, 95%, 2-Chloro-6-fluoro-1H-1,3-benzodiazole hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg.
2-chloro-6-fluoro-1H-benzimidazole;hydrochloride (CAS 2172528-12-8) is a chemical compound with the molecular formula C7H5Cl2FN2 and a molecular weight of 207.03 g/mol. IUPAC name: 2-chloro-6-fluoro-1H-benzimidazole;hydrochloride. InChIKey: LHSNXQDDGUHWOX-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2FN2 |
|---|---|
| Molecular weight | 207.03 g/mol |
| IUPAC name | 2-chloro-6-fluoro-1H-benzimidazole;hydrochloride |
| InChIKey | LHSNXQDDGUHWOX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC(=N2)Cl.Cl |
Computed by PubChem (NCBI)