CAS 1416438-53-3 is the registry number for 3-(4-Chlorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 500mg.
3-(4-chlorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine (CAS 1416438-53-3) is a chemical compound with the molecular formula C12H12ClN3 and a molecular weight of 233.69 g/mol. IUPAC name: 3-(4-chlorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine. InChIKey: HSEPXCGSFZTBDU-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine |
| InChIKey | HSEPXCGSFZTBDU-UHFFFAOYSA-N |
| SMILES | C1CN2C(=NC=C2C3=CC=C(C=C3)Cl)CN1 |
Computed by PubChem (NCBI)