CAS 1416447-74-9 appears in our catalog under these names: 8-Ethyl-2,5-dimethylquinoline, 95%, 8-Ethyl-2,5-dimethylquinoline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
8-ethyl-2,5-dimethylquinoline (CAS 1416447-74-9) is a chemical compound with the molecular formula C13H15N and a molecular weight of 185.26 g/mol. IUPAC name: 8-ethyl-2,5-dimethylquinoline. InChIKey: CJDDZWALNFEDGF-UHFFFAOYSA-N.
| Molecular formula | C13H15N |
|---|---|
| Molecular weight | 185.26 g/mol |
| IUPAC name | 8-ethyl-2,5-dimethylquinoline |
| InChIKey | CJDDZWALNFEDGF-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=C(C=C1)C)C=CC(=N2)C |
Computed by PubChem (NCBI)