CAS 1416721-79-3 is the registry number for 2-Chloro-4-formylpyridine-5-boronic acid pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-4-carbaldehyde (CAS 1416721-79-3) is a chemical compound with the molecular formula C12H15BClNO3 and a molecular weight of 267.52 g/mol. IUPAC name: 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-4-carbaldehyde. InChIKey: XQDJQRYJJHGRTJ-UHFFFAOYSA-N.
| Molecular formula | C12H15BClNO3 |
|---|---|
| Molecular weight | 267.52 g/mol |
| IUPAC name | 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-4-carbaldehyde |
| InChIKey | XQDJQRYJJHGRTJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2C=O)Cl |
Computed by PubChem (NCBI)