Products 1704082-24-5
CAS 1704082-24-5 is the registry number for (4–chloro–3–(cyclopentylcarbaMoyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[4-chloro-3-(cyclopentylcarbamoyl)phenyl]boronic acid (CAS 1704082-24-5) is a chemical compound with the molecular formula C12H15BClNO3 and a molecular weight of 267.52 g/mol. IUPAC name: [4-chloro-3-(cyclopentylcarbamoyl)phenyl]boronic acid. InChIKey: DHRYTZMWCBVQAJ-UHFFFAOYSA-N.
| Molecular formula | C12H15BClNO3 |
|---|---|
| Molecular weight | 267.52 g/mol |
| IUPAC name | [4-chloro-3-(cyclopentylcarbamoyl)phenyl]boronic acid |
| InChIKey | DHRYTZMWCBVQAJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)C(=O)NC2CCCC2)(O)O |
Computed by PubChem (NCBI)