Products 141675-48-1
CAS 141675-48-1 appears in our catalog under these names: Deferiprone 3-O-β-D-glucuronide, Deferiprone 3-O-b-D-glucuronide, Deferiprone O-β-D-glucuronide. Offered by: Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 0,5mg, 10mg, 1mg, 5mg, Get quote.
(2S,3S,4S,5R,6S)-6-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 141675-48-1) is a chemical compound with the molecular formula C13H17NO8 and a molecular weight of 315.28 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: VOJFZOAEFOZFIL-JDQAZDLZSA-N.
| Molecular formula | C13H17NO8 |
|---|---|
| Molecular weight | 315.28 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | VOJFZOAEFOZFIL-JDQAZDLZSA-N |
| SMILES | CC1=C(C(=O)C=CN1C)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O |
Computed by PubChem (NCBI)