CAS 700368-52-1 is the registry number for (4-Nitrophenyl)methyl-b-D-glucopyranoside. Offered by: Biosynth. Available pack sizes: 5g, 2g.
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(4-nitrophenyl)methoxy]oxane-3,4,5-triol (CAS 700368-52-1) is a chemical compound with the molecular formula C13H17NO8 and a molecular weight of 315.28 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(4-nitrophenyl)methoxy]oxane-3,4,5-triol. InChIKey: WDXXNSLGRCTMAE-UJPOAAIJSA-N.
| Molecular formula | C13H17NO8 |
|---|---|
| Molecular weight | 315.28 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(4-nitrophenyl)methoxy]oxane-3,4,5-triol |
| InChIKey | WDXXNSLGRCTMAE-UJPOAAIJSA-N |
| SMILES | C1=CC(=CC=C1CO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)