Products 1416775-96-6
CAS 1416775-96-6 is the registry number for N-[1-(3-Bromophenyl)-4-piperidyl]-N-methylacetamide, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
N-[1-(3-bromophenyl)piperidin-4-yl]-N-methylacetamide (CAS 1416775-96-6) is a chemical compound with the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. IUPAC name: N-[1-(3-bromophenyl)piperidin-4-yl]-N-methylacetamide. InChIKey: GAHJQOOFWKJTBZ-UHFFFAOYSA-N.
| Molecular formula | C14H19BrN2O |
|---|---|
| Molecular weight | 311.22 g/mol |
| IUPAC name | N-[1-(3-bromophenyl)piperidin-4-yl]-N-methylacetamide |
| InChIKey | GAHJQOOFWKJTBZ-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C)C1CCN(CC1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)