CAS 1416801-65-4 appears in our catalog under these names: Methyl 2–chloroquinoline–7–carboxylate, Methyl2-chloroquinoline-7-carboxylate. Offered by: GLPBio, Biosynth. Available pack sizes: 25mg, 250mg, 2,5g.
Methyl 2-chloroquinoline-7-carboxylate (CAS 1416801-65-4) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: methyl 2-chloroquinoline-7-carboxylate. InChIKey: TYFIRXIWXORECM-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | methyl 2-chloroquinoline-7-carboxylate |
| InChIKey | TYFIRXIWXORECM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=CC(=N2)Cl |
Computed by PubChem (NCBI)