CAS 1417341-55-9 appears in our catalog under these names: 5-[(Trifluoromethyl)sulphonyl]-1h-benzimidazole, 95%, 5-((Trifluoromethyl)sulfonyl)-1H-benzo(d)imidazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
6-(trifluoromethylsulfonyl)-1H-benzimidazole (CAS 1417341-55-9) is a chemical compound with the molecular formula C8H5F3N2O2S and a molecular weight of 250.20 g/mol. IUPAC name: 6-(trifluoromethylsulfonyl)-1H-benzimidazole. InChIKey: JEOFJOWCWVPMTM-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O2S |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | 6-(trifluoromethylsulfonyl)-1H-benzimidazole |
| InChIKey | JEOFJOWCWVPMTM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)C(F)(F)F)NC=N2 |
Computed by PubChem (NCBI)