Products 2055107-42-9
CAS 2055107-42-9 is the registry number for 6-(2,2,2-Trifluoroethyl)thieno[2,3-d]pyrimidine-2,4(1H,3H)-dione, 97%. Offered by: Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g, 100g.
6-(2,2,2-trifluoroethyl)-1H-thieno[2,3-d]pyrimidine-2,4-dione (CAS 2055107-42-9) is a chemical compound with the molecular formula C8H5F3N2O2S and a molecular weight of 250.20 g/mol. IUPAC name: 6-(2,2,2-trifluoroethyl)-1H-thieno[2,3-d]pyrimidine-2,4-dione. InChIKey: LGVZFUJFUVQTBZ-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O2S |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | 6-(2,2,2-trifluoroethyl)-1H-thieno[2,3-d]pyrimidine-2,4-dione |
| InChIKey | LGVZFUJFUVQTBZ-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1C(=O)NC(=O)N2)CC(F)(F)F |
Computed by PubChem (NCBI)