Products 923676-92-0
CAS 923676-92-0 appears in our catalog under these names: 4-Cyano-3-(trifluoromethyl)benzenesulfonamide, 95%, 4-Cyano-3-(trifluoromethyl)benzenesulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
4-cyano-3-(trifluoromethyl)benzenesulfonamide (CAS 923676-92-0) is a chemical compound with the molecular formula C8H5F3N2O2S and a molecular weight of 250.20 g/mol. IUPAC name: 4-cyano-3-(trifluoromethyl)benzenesulfonamide. InChIKey: NDNVZATXCGMNHR-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O2S |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | 4-cyano-3-(trifluoromethyl)benzenesulfonamide |
| InChIKey | NDNVZATXCGMNHR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)N)C(F)(F)F)C#N |
Computed by PubChem (NCBI)