Products 1417737-67-7
CAS 1417737-67-7 is the registry number for CatB-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(8-hydroxy-5-nitroquinolin-7-yl)methylamino]acetonitrile (CAS 1417737-67-7) is a chemical compound with the molecular formula C12H10N4O3 and a molecular weight of 258.23 g/mol. IUPAC name: 2-[(8-hydroxy-5-nitroquinolin-7-yl)methylamino]acetonitrile. InChIKey: WCKCUTSAAUXUOC-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O3 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 2-[(8-hydroxy-5-nitroquinolin-7-yl)methylamino]acetonitrile |
| InChIKey | WCKCUTSAAUXUOC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C(=C2N=C1)O)CNCC#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)