CAS 1417793-35-1 is the registry number for 1-(3-Methoxy-4-nitrophenyl)piperidin-4-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-methoxy-4-nitrophenyl)piperidin-4-amine;hydrochloride (CAS 1417793-35-1) is a chemical compound with the molecular formula C12H18ClN3O3 and a molecular weight of 287.74 g/mol. IUPAC name: 1-(3-methoxy-4-nitrophenyl)piperidin-4-amine;hydrochloride. InChIKey: MYDXFTIKUZPHGJ-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN3O3 |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | 1-(3-methoxy-4-nitrophenyl)piperidin-4-amine;hydrochloride |
| InChIKey | MYDXFTIKUZPHGJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N2CCC(CC2)N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)