Products 1417793-35-1

CAS 1417793-35-1 is the registry number for 1-(3-Methoxy-4-nitrophenyl)piperidin-4-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(3-methoxy-4-nitrophenyl)piperidin-4-amine;hydrochloride (CAS 1417793-35-1) is a chemical compound with the molecular formula C12H18ClN3O3 and a molecular weight of 287.74 g/mol. IUPAC name: 1-(3-methoxy-4-nitrophenyl)piperidin-4-amine;hydrochloride. InChIKey: MYDXFTIKUZPHGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18ClN3O3
Molecular weight287.74 g/mol
IUPAC name1-(3-methoxy-4-nitrophenyl)piperidin-4-amine;hydrochloride
InChIKeyMYDXFTIKUZPHGJ-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)N2CCC(CC2)N)[N+](=O)[O-].Cl

Computed by PubChem (NCBI)