CAS 158276-23-4 is the registry number for H–Lys(nicotinoyl)–OH · 2 HCl. Offered by: GLPBio. Available pack sizes: 1g, 5g.
(2S)-2-amino-6-(pyridine-3-carbonylamino)hexanoic acid;hydrochloride (CAS 158276-23-4) is a chemical compound with the molecular formula C12H18ClN3O3 and a molecular weight of 287.74 g/mol. IUPAC name: (2S)-2-amino-6-(pyridine-3-carbonylamino)hexanoic acid;hydrochloride. InChIKey: CCWKVAIEPHOTKE-PPHPATTJSA-N.
| Molecular formula | C12H18ClN3O3 |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | (2S)-2-amino-6-(pyridine-3-carbonylamino)hexanoic acid;hydrochloride |
| InChIKey | CCWKVAIEPHOTKE-PPHPATTJSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)NCCCC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)