CAS 16010-98-3 appears in our catalog under these names: (S)-2-Amino-4-methyl-N-(4-nitrophenyl)pentanamide hydrochloride, 98%, 98%, H-Leu-pNA HCl 98%, L-Leucine p-nitroanilide hydrochloride, 98%, H–Leu–pNA·HCl, L-Leucyl-4-nitroanilide (hydrochloride), 99.97%. Offered by: Chemat, Ambeed, Combi-blocks, GLPBio, MedChemExpress. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 250 mg, 1 g.
(2S)-2-amino-4-methyl-N-(4-nitrophenyl)pentanamide;hydrochloride (CAS 16010-98-3) is a chemical compound with the molecular formula C12H18ClN3O3 and a molecular weight of 287.74 g/mol. IUPAC name: (2S)-2-amino-4-methyl-N-(4-nitrophenyl)pentanamide;hydrochloride. InChIKey: PFOYXOWPGRWPLS-MERQFXBCSA-N.
| Molecular formula | C12H18ClN3O3 |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | (2S)-2-amino-4-methyl-N-(4-nitrophenyl)pentanamide;hydrochloride |
| InChIKey | PFOYXOWPGRWPLS-MERQFXBCSA-N |
| SMILES | CC(C)C[C@@H](C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)