CAS 1417984-69-0 is the registry number for 2-(5-Oxo-3-(trifluoromethyl)-3b,4,4a,5-tetrahydro-1H-cyclopropa[3,4]cyclopenta[1,2-c]pyrazol-1-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[5-oxo-9-(trifluoromethyl)-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]acetic acid (CAS 1417984-69-0) is a chemical compound with the molecular formula C10H7F3N2O3 and a molecular weight of 260.17 g/mol. IUPAC name: 2-[5-oxo-9-(trifluoromethyl)-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]acetic acid. InChIKey: HJZGJAPRXYBJDE-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2O3 |
|---|---|
| Molecular weight | 260.17 g/mol |
| IUPAC name | 2-[5-oxo-9-(trifluoromethyl)-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]acetic acid |
| InChIKey | HJZGJAPRXYBJDE-UHFFFAOYSA-N |
| SMILES | C1C2C1C(=O)C3=C2C(=NN3CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)