Products 165963-72-4

CAS 165963-72-4 is the registry number for 2-Hydroxy-4-(3-(trifluoromethyl)-3H-diazirin-3-yl)benzoic Acid, Methyl Ester. Offered by: TRC. Available pack sizes: 25mg, 5mg.

Structural formula: {0} (CAS {1})

Methyl 2-hydroxy-4-[3-(trifluoromethyl)diazirin-3-yl]benzoate (CAS 165963-72-4) is a chemical compound with the molecular formula C10H7F3N2O3 and a molecular weight of 260.17 g/mol. IUPAC name: methyl 2-hydroxy-4-[3-(trifluoromethyl)diazirin-3-yl]benzoate. InChIKey: UESDLZIPGDGBBE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7F3N2O3
Molecular weight260.17 g/mol
IUPAC namemethyl 2-hydroxy-4-[3-(trifluoromethyl)diazirin-3-yl]benzoate
InChIKeyUESDLZIPGDGBBE-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=C1)C2(N=N2)C(F)(F)F)O

Computed by PubChem (NCBI)