CAS 165963-72-4 is the registry number for 2-Hydroxy-4-(3-(trifluoromethyl)-3H-diazirin-3-yl)benzoic Acid, Methyl Ester. Offered by: TRC. Available pack sizes: 25mg, 5mg.
Methyl 2-hydroxy-4-[3-(trifluoromethyl)diazirin-3-yl]benzoate (CAS 165963-72-4) is a chemical compound with the molecular formula C10H7F3N2O3 and a molecular weight of 260.17 g/mol. IUPAC name: methyl 2-hydroxy-4-[3-(trifluoromethyl)diazirin-3-yl]benzoate. InChIKey: UESDLZIPGDGBBE-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2O3 |
|---|---|
| Molecular weight | 260.17 g/mol |
| IUPAC name | methyl 2-hydroxy-4-[3-(trifluoromethyl)diazirin-3-yl]benzoate |
| InChIKey | UESDLZIPGDGBBE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C2(N=N2)C(F)(F)F)O |
Computed by PubChem (NCBI)