CAS 1557725-62-8 appears in our catalog under these names: 2-Oxo-3-(2,2,2-trifluoroethyl)-2,3-dihydro-1H-1,3-benzodiazole-5-carboxylic acid, 95%, 2-Oxo-3-(2,2,2-trifluoroethyl)-2,3-dihydro-1H-1,3-benzodiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-oxo-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-5-carboxylic acid (CAS 1557725-62-8) is a chemical compound with the molecular formula C10H7F3N2O3 and a molecular weight of 260.17 g/mol. IUPAC name: 2-oxo-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-5-carboxylic acid. InChIKey: FSJPHZNUPMTSNX-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2O3 |
|---|---|
| Molecular weight | 260.17 g/mol |
| IUPAC name | 2-oxo-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-5-carboxylic acid |
| InChIKey | FSJPHZNUPMTSNX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)N(C(=O)N2)CC(F)(F)F |
Computed by PubChem (NCBI)