CAS 1418117-82-4 appears in our catalog under these names: 7–Methoxyquinoline Hydrochloride, 7-Methoxyquinoline hydrochloride 97%, 7-Methoxyquinoline Hydrochloride, 99.83% ,, 99.83% ,. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 50mg, 100mg.
7-methoxyquinoline;hydrochloride (CAS 1418117-82-4) is a chemical compound with the molecular formula C10H10ClNO and a molecular weight of 195.64 g/mol. IUPAC name: 7-methoxyquinoline;hydrochloride. InChIKey: WBDYBWPAQXRERD-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | 7-methoxyquinoline;hydrochloride |
| InChIKey | WBDYBWPAQXRERD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CC=N2)C=C1.Cl |
Computed by PubChem (NCBI)