Products 1418130-37-6
CAS 1418130-37-6 is the registry number for 3-Amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 5g.
3-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1418130-37-6) is a chemical compound with the molecular formula C13H19BN2O3 and a molecular weight of 262.11 g/mol. IUPAC name: 3-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: AQDRZHKBCYKTIR-UHFFFAOYSA-N.
| Molecular formula | C13H19BN2O3 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | 3-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | AQDRZHKBCYKTIR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)N)C(=O)N |
Computed by PubChem (NCBI)