Products 1418131-46-0
CAS 1418131-46-0 appears in our catalog under these names: RSC-133, RSC–133, RSC133, RSC133, 98.45%, RSC-133, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 1 mg.
3-[[(E)-3-(1H-indol-3-yl)prop-2-enoyl]amino]benzamide (CAS 1418131-46-0) is a chemical compound with the molecular formula C18H15N3O2 and a molecular weight of 305.3 g/mol. IUPAC name: 3-[[(E)-3-(1H-indol-3-yl)prop-2-enoyl]amino]benzamide. InChIKey: HYUDSQGICKAEGE-CMDGGOBGSA-N.
| Molecular formula | C18H15N3O2 |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | 3-[[(E)-3-(1H-indol-3-yl)prop-2-enoyl]amino]benzamide |
| InChIKey | HYUDSQGICKAEGE-CMDGGOBGSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)/C=C/C(=O)NC3=CC=CC(=C3)C(=O)N |
Computed by PubChem (NCBI)