Products 294211-85-1
CAS 294211-85-1 is the registry number for 5,5''-Dimethyl-[2,2':6',2''-terpyridine]-4'-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-bis(5-methyl-2-pyridinyl)pyridine-4-carboxylic acid (CAS 294211-85-1) is a chemical compound with the molecular formula C18H15N3O2 and a molecular weight of 305.3 g/mol. IUPAC name: 2,6-bis(5-methyl-2-pyridinyl)pyridine-4-carboxylic acid. InChIKey: ONKZNQJYOBPKCW-UHFFFAOYSA-N.
| Molecular formula | C18H15N3O2 |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | 2,6-bis(5-methyl-2-pyridinyl)pyridine-4-carboxylic acid |
| InChIKey | ONKZNQJYOBPKCW-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C=C1)C2=CC(=CC(=N2)C3=NC=C(C=C3)C)C(=O)O |
Computed by PubChem (NCBI)