CAS 148332-31-4 appears in our catalog under these names: ETHYL 2,2':6',2''–TERPYRIDINE–4'–CARBOXYLATE, Ethyl [2,2':6',2''-terpyridine]-4'-carboxylate, 98%, Ethyl [2,2':6',2''-terpyridine]-4'-carboxylate, 98%, 98%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100mg.
Ethyl 2,6-dipyridin-2-ylpyridine-4-carboxylate (CAS 148332-31-4) is a chemical compound with the molecular formula C18H15N3O2 and a molecular weight of 305.3 g/mol. IUPAC name: ethyl 2,6-dipyridin-2-ylpyridine-4-carboxylate. InChIKey: COUKWHIHLXNYAH-UHFFFAOYSA-N.
| Molecular formula | C18H15N3O2 |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | ethyl 2,6-dipyridin-2-ylpyridine-4-carboxylate |
| InChIKey | COUKWHIHLXNYAH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NC(=C1)C2=CC=CC=N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)