CAS 141860-78-8 is the registry number for (Z)-Ethyl 3-amino-4,4,4-trifluorobut-2-enoate, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Ethyl (Z)-3-amino-4,4,4-trifluorobut-2-enoate (CAS 141860-78-8) is a chemical compound with the molecular formula C6H8F3NO2 and a molecular weight of 183.13 g/mol. IUPAC name: ethyl (Z)-3-amino-4,4,4-trifluorobut-2-enoate. InChIKey: NXVKRKUGIINGHD-ARJAWSKDSA-N.
| Molecular formula | C6H8F3NO2 |
|---|---|
| Molecular weight | 183.13 g/mol |
| IUPAC name | ethyl (Z)-3-amino-4,4,4-trifluorobut-2-enoate |
| InChIKey | NXVKRKUGIINGHD-ARJAWSKDSA-N |
| SMILES | CCOC(=O)/C=C(/C(F)(F)F)\N |
Computed by PubChem (NCBI)