Products 498583-09-8
CAS 498583-09-8 appears in our catalog under these names: Ethyl (E)-3-Amino-4,4,4-trifluoro-2-butenoate, 98%, 98%, Ethyl (E)-3-amino-4,4,4-trifluorobut-2-enoate, ≥97%. Offered by: Chemat, Fluorochem. Available pack sizes: 25g.
Ethyl (E)-3-amino-4,4,4-trifluorobut-2-enoate (CAS 498583-09-8) is a chemical compound with the molecular formula C6H8F3NO2 and a molecular weight of 183.13 g/mol. IUPAC name: ethyl (E)-3-amino-4,4,4-trifluorobut-2-enoate. InChIKey: NXVKRKUGIINGHD-ONEGZZNKSA-N.
| Molecular formula | C6H8F3NO2 |
|---|---|
| Molecular weight | 183.13 g/mol |
| IUPAC name | ethyl (E)-3-amino-4,4,4-trifluorobut-2-enoate |
| InChIKey | NXVKRKUGIINGHD-ONEGZZNKSA-N |
| SMILES | CCOC(=O)/C=C(\C(F)(F)F)/N |
Computed by PubChem (NCBI)
Synonyms:
Ethyl (E)-3-Amino-4,4,4-trifluoro-2-butenoate, (E)-Ethyl 3-amino-4,4,4-trifluorocrotonate, ethyl (E)-3-amino-4,4,4-trifluorobut-2-enoate, Ethyl 3-amino-4,4,4-trifluorocrotonate, 96%, Ethyl(E)-3-Amino-4,4,4-trifluoro-2-butenoate, (E)-ethyl 3-amino-4,4,4-trifluorobut-2-enoate, ethyl (E)-3-amino-4,4,4-trifluoro-but-2-enoate