Products 1419610-67-5
CAS 1419610-67-5 is the registry number for N-Boc-1-ethyl-5-methyl-1H-pyrazol-4-amine, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-(1-ethyl-5-methylpyrazol-4-yl)carbamate (CAS 1419610-67-5) is a chemical compound with the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. IUPAC name: tert-butyl N-(1-ethyl-5-methylpyrazol-4-yl)carbamate. InChIKey: LHTKIJIQCIJGCC-UHFFFAOYSA-N.
| Molecular formula | C11H19N3O2 |
|---|---|
| Molecular weight | 225.29 g/mol |
| IUPAC name | tert-butyl N-(1-ethyl-5-methylpyrazol-4-yl)carbamate |
| InChIKey | LHTKIJIQCIJGCC-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C=N1)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)