CAS 1419789-69-7 is the registry number for 4'-Ethynyl-3,4-difluoro-biphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-(4-ethynylphenyl)-1,2-difluorobenzene (CAS 1419789-69-7) is a chemical compound with the molecular formula C14H8F2 and a molecular weight of 214.21 g/mol. IUPAC name: 4-(4-ethynylphenyl)-1,2-difluorobenzene. InChIKey: VQYUWOJZLNSKIE-UHFFFAOYSA-N.
| Molecular formula | C14H8F2 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | 4-(4-ethynylphenyl)-1,2-difluorobenzene |
| InChIKey | VQYUWOJZLNSKIE-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)