Products 23349-16-8
CAS 23349-16-8 is the registry number for 1,2-Bis(3-fluorophenyl)ethyne, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
1-fluoro-3-[2-(3-fluorophenyl)ethynyl]benzene (CAS 23349-16-8) is a chemical compound with the molecular formula C14H8F2 and a molecular weight of 214.21 g/mol. IUPAC name: 1-fluoro-3-[2-(3-fluorophenyl)ethynyl]benzene. InChIKey: SNNLUYWPLZLTQX-UHFFFAOYSA-N.
| Molecular formula | C14H8F2 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | 1-fluoro-3-[2-(3-fluorophenyl)ethynyl]benzene |
| InChIKey | SNNLUYWPLZLTQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C#CC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)