CAS 2279123-83-8 is the registry number for 4'-Ethynyl-3,5-difluoro-biphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(4-ethynylphenyl)-3,5-difluorobenzene (CAS 2279123-83-8) is a chemical compound with the molecular formula C14H8F2 and a molecular weight of 214.21 g/mol. IUPAC name: 1-(4-ethynylphenyl)-3,5-difluorobenzene. InChIKey: IJYUCOIOQUSQTO-UHFFFAOYSA-N.
| Molecular formula | C14H8F2 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | 1-(4-ethynylphenyl)-3,5-difluorobenzene |
| InChIKey | IJYUCOIOQUSQTO-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)