Products 142048-54-2
CAS 142048-54-2 is the registry number for 4-(4-Chloro-3-fluorophenyl)-4-oxobutyric acid, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
4-(4-chloro-3-fluorophenyl)-4-oxobutanoic acid (CAS 142048-54-2) is a chemical compound with the molecular formula C10H8ClFO3 and a molecular weight of 230.62 g/mol. IUPAC name: 4-(4-chloro-3-fluorophenyl)-4-oxobutanoic acid. InChIKey: IRQZAGWHZPBKOD-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFO3 |
|---|---|
| Molecular weight | 230.62 g/mol |
| IUPAC name | 4-(4-chloro-3-fluorophenyl)-4-oxobutanoic acid |
| InChIKey | IRQZAGWHZPBKOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CCC(=O)O)F)Cl |
Computed by PubChem (NCBI)