Products 14207-31-9
CAS 14207-31-9 appears in our catalog under these names: 4-Bromo-2,5-dimethylbenzene-1-sulfonamide, 95%, 4-Bromo-2,5-dimethylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 25mg, 0,5g, 50mg.
4-bromo-2,5-dimethylbenzenesulfonamide (CAS 14207-31-9) is a chemical compound with the molecular formula C8H10BrNO2S and a molecular weight of 264.14 g/mol. IUPAC name: 4-bromo-2,5-dimethylbenzenesulfonamide. InChIKey: WVYBHJDWFXFZAY-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO2S |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | 4-bromo-2,5-dimethylbenzenesulfonamide |
| InChIKey | WVYBHJDWFXFZAY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C)S(=O)(=O)N |
Computed by PubChem (NCBI)