Products 1420800-36-7
CAS 1420800-36-7 is the registry number for 3-Bromo-4-(methylamino)-5-nitrobenzonitrile, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 1g, 5g.
3-bromo-4-(methylamino)-5-nitrobenzonitrile (CAS 1420800-36-7) is a chemical compound with the molecular formula C8H6BrN3O2 and a molecular weight of 256.06 g/mol. IUPAC name: 3-bromo-4-(methylamino)-5-nitrobenzonitrile. InChIKey: QDQCZTLDQOWPIB-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O2 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 3-bromo-4-(methylamino)-5-nitrobenzonitrile |
| InChIKey | QDQCZTLDQOWPIB-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1Br)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)